C13H18N4O4S — CID 98777427
N-[(3R,3aS,7aR)-1-(pyrazine-2-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide (PubChem CID 98777427) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[(3R,3aS,7aR)-1-(pyrazine-2-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,3aS,7aR)-1-(pyrazine-2-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 98777427 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(3R,3aS,7aR)-1-(pyrazine-2-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CN(C(=O)c2cnccn2)[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C13H18N4O4S/c1-22(19,20)16-10-8-17(11-3-2-6-21-12(10)11)13(18)9-7-14-4-5-15-9/h4-5,7,10-12,16H,2-3,6,8H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | IBARLWDBWIPGJI-IJLUTSLNSA-N |
| XLogP | -0.60 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |