C12H17N3O2S — CID 98777443
N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 98777443) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 98777443 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[(3S,3aS,7aS)-1-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CN1C[C@H](NC(=O)c2cscn2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C12H17N3O2S/c1-15-5-8(11-10(15)3-2-4-17-11)14-12(16)9-6-18-7-13-9/h6-8,10-11H,2-5H2,1H3,(H,14,16)/t8-,10-,11-/m0/s1 |
| InChIKey | NLFNKRQBUIZIKO-LSJOCFKGSA-N |
| XLogP | 0.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |