C12H17N3O4S2 — CID 98777540
N-[(3S,3aS,7aR)-1-(1,3-thiazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide (PubChem CID 98777540) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[(3S,3aS,7aR)-1-(1,3-thiazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[(3S,3aS,7aR)-1-(1,3-thiazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 98777540 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(3S,3aS,7aR)-1-(1,3-thiazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CN(C(=O)c2cscn2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C12H17N3O4S2/c1-21(17,18)14-8-5-15(10-3-2-4-19-11(8)10)12(16)9-6-20-7-13-9/h6-8,10-11,14H,2-5H2,1H3/t8-,10+,11+/m0/s1 |
| InChIKey | YLSWOIGHVOCFLO-JMJZKYOTSA-N |
| XLogP | 0.06 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |