C13H20N4O4S — CID 98777546
N-[(3S,3aR,7aR)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 98777546) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[(3S,3aR,7aR)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(3S,3aR,7aR)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 98777546 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[(3S,3aR,7aR)-1-methylsulfonyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@H]2CN(S(C)(=O)=O)[C@@H]3CCCO[C@H]23)cn1 |
| InChI | InChI=1S/C13H20N4O4S/c1-16-7-9(6-14-16)13(18)15-10-8-17(22(2,19)20)11-4-3-5-21-12(10)11/h6-7,10-12H,3-5,8H2,1-2H3,(H,15,18)/t10-,11+,12+/m0/s1 |
| InChIKey | WOOLEYIPEZJWJI-QJPTWQEYSA-N |
| XLogP | -0.66 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |