C21H30N2O3 — CID 98777555
[(3aR,5S,7aR)-1-(2-phenylmethoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 98777555) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(3aR,5S,7aR)-1-(2-phenylmethoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aR,5S,7aR)-1-(2-phenylmethoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 98777555 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [(3aR,5S,7aR)-1-(2-phenylmethoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CC[C@@H]2[C@@H](CCN2CCOCc2ccccc2)O1)N1CCCC1 |
| InChI | InChI=1S/C21H30N2O3/c24-21(23-11-4-5-12-23)20-9-8-18-19(26-20)10-13-22(18)14-15-25-16-17-6-2-1-3-7-17/h1-3,6-7,18-20H,4-5,8-16H2/t18-,19-,20+/m1/s1 |
| InChIKey | KJXJRDFEKDKUEQ-AQNXPRMDSA-N |
| XLogP | 2.45 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|