C20H26N4O2 — CID 98778149
(3R,5R)-N-(4-methoxyphenyl)-9-(5-methylpyrimidin-2-yl)-1-oxa-9-azaspiro[4.5]decan-3-amine (PubChem CID 98778149) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3R,5R)-N-(4-methoxyphenyl)-9-(5-methylpyrimidin-2-yl)-1-oxa-9-azaspiro[4.5]decan-3-amine.
| Compound Name | (3R,5R)-N-(4-methoxyphenyl)-9-(5-methylpyrimidin-2-yl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 98778149 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3R,5R)-N-(4-methoxyphenyl)-9-(5-methylpyrimidin-2-yl)-1-oxa-9-azaspiro[4.5]decan-3-amine |
| SMILES | COc1ccc(N[C@H]2CO[C@]3(CCCN(c4ncc(C)cn4)C3)C2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-15-11-21-19(22-12-15)24-9-3-8-20(14-24)10-17(13-26-20)23-16-4-6-18(25-2)7-5-16/h4-7,11-12,17,23H,3,8-10,13-14H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | MELNBPWHKMAFMO-YLJYHZDGSA-N |
| XLogP | 3.03 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|