About N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide
N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide (PubChem CID 98778833) has the molecular formula C11H16N4O2S
and a molecular weight of 268.34 g/mol. Its IUPAC name is N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide |
| PubChem CID | 98778833 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide |
| SMILES | Cc1cnc(N2C[C@@H]3C(NS(C)(=O)=O)[C@@H]3C2)nc1 |
| InChI | InChI=1S/C11H16N4O2S/c1-7-3-12-11(13-4-7)15-5-8-9(6-15)10(8)14-18(2,16)17/h3-4,8-10,14H,5-6H2,1-2H3/t8-,9+,10? |
| InChIKey | RXHZZXYWMFUZAY-ULKQDVFKSA-N |
| XLogP | -0.23 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide?
The IUPAC name of N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide (CID 98778833) is N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide.
What is the SMILES notation for N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide?
The canonical SMILES for N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide is Cc1cnc(N2C[C@@H]3C(NS(C)(=O)=O)[C@@H]3C2)nc1.
What is the InChIKey of N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide?
The InChIKey is RXHZZXYWMFUZAY-ULKQDVFKSA-N. The full InChI is InChI=1S/C11H16N4O2S/c1-7-3-12-11(13-4-7)15-5-8-9(6-15)10(8)14-18(2,16)17/h3-4,8-10,14H,5-6H2,1-2H3/t8-,9+,10?.
What are the key properties of N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide?
N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide has a molecular weight of 268.34 g/mol, XLogP of -0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,5S)-3-(5-methylpyrimidin-2-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methanesulfonamide is sourced from PubChem (CID 98778833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).