C20H22N2O2 — CID 98780108
(1S,5S,6S)-3-benzyl-N-phenyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 98780108) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (1S,5S,6S)-3-benzyl-N-phenyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | (1S,5S,6S)-3-benzyl-N-phenyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 98780108 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1S,5S,6S)-3-benzyl-N-phenyl-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1C[C@H]2CN(Cc3ccccc3)C[C@H]1O2 |
| InChI | InChI=1S/C20H22N2O2/c23-20(21-16-9-5-2-6-10-16)18-11-17-13-22(14-19(18)24-17)12-15-7-3-1-4-8-15/h1-10,17-19H,11-14H2,(H,21,23)/t17-,18-,19+/m0/s1 |
| InChIKey | SPILNSFRGPPHMB-GBESFXJTSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |