C12H17NO3 — CID 98783832
3-(3-ethyl-4-methoxyanilino)propanoic acid (PubChem CID 98783832) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(3-ethyl-4-methoxyanilino)propanoic acid.
| Compound Name | 3-(3-ethyl-4-methoxyanilino)propanoic acid |
|---|---|
| PubChem CID | 98783832 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(3-ethyl-4-methoxyanilino)propanoic acid |
| SMILES | CCc1cc(NCCC(=O)O)ccc1OC |
| InChI | InChI=1S/C12H17NO3/c1-3-9-8-10(4-5-11(9)16-2)13-7-6-12(14)15/h4-5,8,13H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | AHHSCHUKSSOADK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|