C18H22N4O2 — CID 98785097
4-[(1R)-1-[(5S)-2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl]ethyl]benzonitrile (PubChem CID 98785097) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[(1R)-1-[(5S)-2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl]ethyl]benzonitrile.
| Compound Name | 4-[(1R)-1-[(5S)-2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 98785097 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[(1R)-1-[(5S)-2,4-dioxo-3-propan-2-yl-1,3,7-triazaspiro[4.4]nonan-7-yl]ethyl]benzonitrile |
| SMILES | CC(C)N1C(=O)N[C@]2(CCN([C@H](C)c3ccc(C#N)cc3)C2)C1=O |
| InChI | InChI=1S/C18H22N4O2/c1-12(2)22-16(23)18(20-17(22)24)8-9-21(11-18)13(3)15-6-4-14(10-19)5-7-15/h4-7,12-13H,8-9,11H2,1-3H3,(H,20,24)/t13-,18+/m1/s1 |
| InChIKey | CFYZZHAAPHJWFT-ACJLOTCBSA-N |
| XLogP | 2.02 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|