C15H26N2O2S2 — CID 98785443
3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea (PubChem CID 98785443) has the molecular formula C15H26N2O2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea.
| Compound Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea |
|---|---|
| PubChem CID | 98785443 |
| Molecular Formula | C15H26N2O2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-[(3R)-1,1-dioxothiolan-3-yl]-1-propylthiourea |
| SMILES | CCCN(C(=S)N[C@@H]1C[C@H]2CC[C@H]1C2)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H26N2O2S2/c1-2-6-17(13-5-7-21(18,19)10-13)15(20)16-14-9-11-3-4-12(14)8-11/h11-14H,2-10H2,1H3,(H,16,20)/t11-,12-,13+,14+/m0/s1 |
| InChIKey | MZNHBZVYHIIWDT-IGQOVBAYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|