C20H24N2O — CID 98785559
N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-pyrrol-1-ylbenzamide (PubChem CID 98785559) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 98785559 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-pyrrol-1-ylbenzamide |
| SMILES | C[C@@H](NC(=O)c1cccc(-n2cccc2)c1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C20H24N2O/c1-14(19-12-15-7-8-16(19)11-15)21-20(23)17-5-4-6-18(13-17)22-9-2-3-10-22/h2-6,9-10,13-16,19H,7-8,11-12H2,1H3,(H,21,23)/t14-,15+,16+,19+/m1/s1 |
| InChIKey | UGLVUBDQRNMGLP-DRMAHVMPSA-N |
| XLogP | 4.03 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |