C19H27NO — CID 98788635
4-[(1R,2R,5R)-4,4-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonan-2-yl]-N,N-dimethylaniline (PubChem CID 98788635) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 4-[(1R,2R,5R)-4,4-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonan-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(1R,2R,5R)-4,4-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonan-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 98788635 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 4-[(1R,2R,5R)-4,4-dimethyl-8-methylidene-3-oxabicyclo[3.3.1]nonan-2-yl]-N,N-dimethylaniline |
| SMILES | C=C1CC[C@@H]2C[C@H]1[C@H](c1ccc(N(C)C)cc1)OC2(C)C |
| InChI | InChI=1S/C19H27NO/c1-13-6-9-15-12-17(13)18(21-19(15,2)3)14-7-10-16(11-8-14)20(4)5/h7-8,10-11,15,17-18H,1,6,9,12H2,2-5H3/t15-,17-,18+/m1/s1 |
| InChIKey | NCCGSJYFIKPSKH-NXHRZFHOSA-N |
| XLogP | 4.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|