C19H27N3OS — CID 98789024
4-(4-heptyl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 98789024) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 4-(4-heptyl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-heptyl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 98789024 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-(4-heptyl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCCCCN1CCOc2ccc(-c3nc(N)sc3C)cc21 |
| InChI | InChI=1S/C19H27N3OS/c1-3-4-5-6-7-10-22-11-12-23-17-9-8-15(13-16(17)22)18-14(2)24-19(20)21-18/h8-9,13H,3-7,10-12H2,1-2H3,(H2,20,21) |
| InChIKey | DADFLHBXIRHBSU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|