C17H28N2O3S — CID 98791750
N-[3-[(2S,5S)-2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]propyl]methanesulfonamide (PubChem CID 98791750) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[3-[(2S,5S)-2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(2S,5S)-2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 98791750 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[3-[(2S,5S)-2-(2,5-dimethylphenyl)-5-methylmorpholin-4-yl]propyl]methanesulfonamide |
| SMILES | Cc1ccc(C)c([C@H]2CN(CCCNS(C)(=O)=O)[C@@H](C)CO2)c1 |
| InChI | InChI=1S/C17H28N2O3S/c1-13-6-7-14(2)16(10-13)17-11-19(15(3)12-22-17)9-5-8-18-23(4,20)21/h6-7,10,15,17-18H,5,8-9,11-12H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | LLVHXZKCEVBSOU-DOTOQJQBSA-N |
| XLogP | 2.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|