C14H25N5O — CID 98798236
1-[[(3S)-1-ethylpyrrolidin-3-yl]methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea (PubChem CID 98798236) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-[[(3S)-1-ethylpyrrolidin-3-yl]methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea.
| Compound Name | 1-[[(3S)-1-ethylpyrrolidin-3-yl]methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 98798236 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 1-[[(3S)-1-ethylpyrrolidin-3-yl]methyl]-3-[(2R)-1-pyrazol-1-ylpropan-2-yl]urea |
| SMILES | CCN1CC[C@@H](CNC(=O)N[C@H](C)Cn2cccn2)C1 |
| InChI | InChI=1S/C14H25N5O/c1-3-18-8-5-13(11-18)9-15-14(20)17-12(2)10-19-7-4-6-16-19/h4,6-7,12-13H,3,5,8-11H2,1-2H3,(H2,15,17,20)/t12-,13+/m1/s1 |
| InChIKey | VQVYIFYZEBCVFV-OLZOCXBDSA-N |
| XLogP | 0.91 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |