C19H35N3O2 — CID 98800181
4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(5-hydroxy-4,4-dimethylpentyl)piperazine-1-carboxamide (PubChem CID 98800181) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(5-hydroxy-4,4-dimethylpentyl)piperazine-1-carboxamide.
| Compound Name | 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(5-hydroxy-4,4-dimethylpentyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 98800181 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-(5-hydroxy-4,4-dimethylpentyl)piperazine-1-carboxamide |
| SMILES | CC(C)(CO)CCCNC(=O)N1CCN([C@@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H35N3O2/c1-19(2,14-23)6-3-7-20-18(24)22-10-8-21(9-11-22)17-13-15-4-5-16(17)12-15/h15-17,23H,3-14H2,1-2H3,(H,20,24)/t15-,16-,17+/m0/s1 |
| InChIKey | QFKUODGPAFHZIM-YESZJQIVSA-N |
| XLogP | 2.30 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|