C29H28N2O4S2 — CID 988097
2-N,7-N-bis(2,3-dimethylphenyl)-9H-fluorene-2,7-disulfonamide (PubChem CID 988097) has the molecular formula C29H28N2O4S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-N,7-N-bis(2,3-dimethylphenyl)-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(2,3-dimethylphenyl)-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 988097 |
| Molecular Formula | C29H28N2O4S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-N,7-N-bis(2,3-dimethylphenyl)-9H-fluorene-2,7-disulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc3c(c2)Cc2cc(S(=O)(=O)Nc4cccc(C)c4C)ccc2-3)c1C |
| InChI | InChI=1S/C29H28N2O4S2/c1-18-7-5-9-28(20(18)3)30-36(32,33)24-11-13-26-22(16-24)15-23-17-25(12-14-27(23)26)37(34,35)31-29-10-6-8-19(2)21(29)4/h5-14,16-17,30-31H,15H2,1-4H3 |
| InChIKey | DPHJGRDVXCSBPJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |