C18H25ClN2O3 — CID 98810492
(3aR,6R,7aR)-4-[2-(4-chlorophenoxy)ethyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 98810492) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is (3aR,6R,7aR)-4-[2-(4-chlorophenoxy)ethyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6R,7aR)-4-[2-(4-chlorophenoxy)ethyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 98810492 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3aR,6R,7aR)-4-[2-(4-chlorophenoxy)ethyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H]2OCC[C@H]2N(CCOc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-20(2)18(22)13-11-17-16(7-9-24-17)21(12-13)8-10-23-15-5-3-14(19)4-6-15/h3-6,13,16-17H,7-12H2,1-2H3/t13-,16-,17-/m1/s1 |
| InChIKey | ZKESXOIOSVQTTE-KBRIMQKVSA-N |
| XLogP | 2.29 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |