C19H30N2O2 — CID 98810834
(4aS,8aS)-6-[(6-methyl-2-pyridinyl)methyl]-4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 98810834) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4aS,8aS)-6-[(6-methyl-2-pyridinyl)methyl]-4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aS)-6-[(6-methyl-2-pyridinyl)methyl]-4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 98810834 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (4aS,8aS)-6-[(6-methyl-2-pyridinyl)methyl]-4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | Cc1cccc(CN2CC[C@@H]3OCCC[C@@]3(COC(C)C)C2)n1 |
| InChI | InChI=1S/C19H30N2O2/c1-15(2)23-14-19-9-5-11-22-18(19)8-10-21(13-19)12-17-7-4-6-16(3)20-17/h4,6-7,15,18H,5,8-14H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | ZBZVUIRSKQEMEE-OALUTQOASA-N |
| XLogP | 3.19 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |