C18H26N4O2 — CID 98810900
N-[(4aS,8R,8aS)-6-cyclopentyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide (PubChem CID 98810900) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-cyclopentyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(4aS,8R,8aS)-6-cyclopentyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 98810900 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-cyclopentyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CN(C2CCCC2)C[C@@H]2CCCO[C@@H]21)c1cnccn1 |
| InChI | InChI=1S/C18H26N4O2/c23-18(15-10-19-7-8-20-15)21-16-12-22(14-5-1-2-6-14)11-13-4-3-9-24-17(13)16/h7-8,10,13-14,16-17H,1-6,9,11-12H2,(H,21,23)/t13-,16+,17-/m0/s1 |
| InChIKey | RKLKVFJPGOEERK-XKQJLSEDSA-N |
| XLogP | 1.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |