C18H23NO4 — CID 98811884
(1R,6R,9S)-5-(1,3-benzodioxol-5-ylmethyl)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonane (PubChem CID 98811884) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (1R,6R,9S)-5-(1,3-benzodioxol-5-ylmethyl)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonane.
| Compound Name | (1R,6R,9S)-5-(1,3-benzodioxol-5-ylmethyl)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 98811884 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (1R,6R,9S)-5-(1,3-benzodioxol-5-ylmethyl)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonane |
| SMILES | C=CCO[C@H]1[C@H]2CC[C@H]1OCCN2Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H23NO4/c1-2-8-21-18-14-4-6-16(18)20-9-7-19(14)11-13-3-5-15-17(10-13)23-12-22-15/h2-3,5,10,14,16,18H,1,4,6-9,11-12H2/t14-,16-,18+/m1/s1 |
| InChIKey | AQLJAIPBPMEWSC-KYJSFNMBSA-N |
| XLogP | 2.35 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|