About DYRK1A/B Inhibitor AnnH31
DYRK1A/B Inhibitor AnnH31 (PubChem CID 9881447) has the molecular formula C15H13N3O
and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetonitrile.
Molecular Properties
| Compound Name | DYRK1A/B Inhibitor AnnH31 |
| PubChem CID | 9881447 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetonitrile |
| SMILES | CC1=NC=CC2=C1N(C3=C2C=CC(=C3)OC)CC#N |
| InChI | InChI=1S/C15H13N3O/c1-10-15-13(5-7-17-10)12-4-3-11(19-2)9-14(12)18(15)8-6-16/h3-5,7,9H,8H2,1-2H3 |
| InChIKey | FCFDJQKAPLIDTQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 377 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze DYRK1A/B Inhibitor AnnH31 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of DYRK1A/B Inhibitor AnnH31?
The IUPAC name of DYRK1A/B Inhibitor AnnH31 (CID 9881447) is 2-(7-methoxy-1-methylpyrido[3,4-b]indol-9-yl)acetonitrile.
What is the SMILES notation for DYRK1A/B Inhibitor AnnH31?
The canonical SMILES for DYRK1A/B Inhibitor AnnH31 is CC1=NC=CC2=C1N(C3=C2C=CC(=C3)OC)CC#N.
What is the InChIKey of DYRK1A/B Inhibitor AnnH31?
The InChIKey is FCFDJQKAPLIDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c1-10-15-13(5-7-17-10)12-4-3-11(19-2)9-14(12)18(15)8-6-16/h3-5,7,9H,8H2,1-2H3.
What are the key properties of DYRK1A/B Inhibitor AnnH31?
DYRK1A/B Inhibitor AnnH31 has a molecular weight of 251.28 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for DYRK1A/B Inhibitor AnnH31 is sourced from PubChem (CID 9881447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).