C21H18ClN3O — CID 988336
(1R)-1-(2-chlorophenyl)-2-naphthalen-1-yl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one (PubChem CID 988336) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-2-naphthalen-1-yl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one.
| Compound Name | (1R)-1-(2-chlorophenyl)-2-naphthalen-1-yl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one |
|---|---|
| PubChem CID | 988336 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-2-naphthalen-1-yl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazol-3-one |
| SMILES | O=C1N(c2cccc3ccccc23)[C@@H](c2ccccc2Cl)N2CCCN12 |
| InChI | InChI=1S/C21H18ClN3O/c22-18-11-4-3-10-17(18)20-23-13-6-14-24(23)21(26)25(20)19-12-5-8-15-7-1-2-9-16(15)19/h1-5,7-12,20H,6,13-14H2/t20-/m0/s1 |
| InChIKey | GAMQBOPSALYWFG-FQEVSTJZSA-N |
| XLogP | 5.05 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |