C16H13BrClNO3S — CID 98835677
(E)-N-[(4-bromothiophen-2-yl)methyl]-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 98835677) has the molecular formula C16H13BrClNO3S and a molecular weight of 414.71 g/mol. Its IUPAC name is (E)-N-[(4-bromothiophen-2-yl)methyl]-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-bromothiophen-2-yl)methyl]-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 98835677 |
| Molecular Formula | C16H13BrClNO3S |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | (E)-N-[(4-bromothiophen-2-yl)methyl]-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C16H13BrClNO3S/c17-11-7-12(23-9-11)8-19-15(20)2-1-10-5-13(18)16-14(6-10)21-3-4-22-16/h1-2,5-7,9H,3-4,8H2,(H,19,20)/b2-1+ |
| InChIKey | VBZIPZOABAQBPT-OWOJBTEDSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|