C21H22N4O2S2 — CID 988444
2-[2,5-dimethyl-3-[(Z)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]-4-methyl-5-propylthiophene-3-carbonitrile (PubChem CID 988444) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(Z)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]-4-methyl-5-propylthiophene-3-carbonitrile.
| Compound Name | 2-[2,5-dimethyl-3-[(Z)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]-4-methyl-5-propylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 988444 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(Z)-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]-4-methyl-5-propylthiophene-3-carbonitrile |
| SMILES | CCCc1sc(-n2c(C)cc(/C=C3/C(=O)NC(=S)N(C)C3=O)c2C)c(C#N)c1C |
| InChI | InChI=1S/C21H22N4O2S2/c1-6-7-17-12(3)16(10-22)20(29-17)25-11(2)8-14(13(25)4)9-15-18(26)23-21(28)24(5)19(15)27/h8-9H,6-7H2,1-5H3,(H,23,26,28)/b15-9- |
| InChIKey | IYGLZYCOAJKEAF-DHDCSXOGSA-N |
| XLogP | 3.54 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|