C20H25N3O3 — CID 98845228
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 98845228) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 98845228 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NCC[C@@H]1C[C@H]2CC[C@H]1C2)c1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C20H25N3O3/c24-18-11-22-20(26)23(18)12-14-2-1-3-17(10-14)19(25)21-7-6-16-9-13-4-5-15(16)8-13/h1-3,10,13,15-16H,4-9,11-12H2,(H,21,25)(H,22,26)/t13-,15-,16+/m0/s1 |
| InChIKey | HQXBOADYQGICBX-CWRNSKLLSA-N |
| XLogP | 2.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|