C18H34N4O2 — CID 98849261
1-ethyl-3-[(3S)-1-(2-methoxyethyl)piperidin-3-yl]-2-[[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine (PubChem CID 98849261) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-ethyl-3-[(3S)-1-(2-methoxyethyl)piperidin-3-yl]-2-[[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(3S)-1-(2-methoxyethyl)piperidin-3-yl]-2-[[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 98849261 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-ethyl-3-[(3S)-1-(2-methoxyethyl)piperidin-3-yl]-2-[[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\C[C@@H]1C[C@H]2CC[C@H]1O2)N[C@H]1CCCN(CCOC)C1 |
| InChI | InChI=1S/C18H34N4O2/c1-3-19-18(20-12-14-11-16-6-7-17(14)24-16)21-15-5-4-8-22(13-15)9-10-23-2/h14-17H,3-13H2,1-2H3,(H2,19,20,21)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | OWKUGYPODRNDIQ-MWDXBVQZSA-N |
| XLogP | 1.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|