C16H22N2O3S — CID 98854201
N-[[(3R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-4-acetylthiophene-2-carboxamide (PubChem CID 98854201) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[[(3R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-4-acetylthiophene-2-carboxamide.
| Compound Name | N-[[(3R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-4-acetylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 98854201 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[[(3R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-4-acetylthiophene-2-carboxamide |
| SMILES | CC(=O)c1csc(C(=O)NC[C@@H]2CN3CCCC[C@H]3CO2)c1 |
| InChI | InChI=1S/C16H22N2O3S/c1-11(19)12-6-15(22-10-12)16(20)17-7-14-8-18-5-3-2-4-13(18)9-21-14/h6,10,13-14H,2-5,7-9H2,1H3,(H,17,20)/t13-,14+/m0/s1 |
| InChIKey | PMUDCZFIZPKPSX-UONOGXRCSA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |