About [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate
[(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate (PubChem CID 98854584) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate.
Molecular Properties
| Compound Name | [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate |
| PubChem CID | 98854584 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate |
| SMILES | CC[C@H](CCOC(=O)[C@H](C)CC)OC(=O)[C@H](C)CC |
| InChI | InChI=1S/C15H28O4/c1-6-11(4)14(16)18-10-9-13(8-3)19-15(17)12(5)7-2/h11-13H,6-10H2,1-5H3/t11-,12-,13-/m1/s1 |
| InChIKey | XJEVJEIFRGPKIE-JHJVBQTASA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate?
The IUPAC name of [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate (CID 98854584) is [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate.
What is the SMILES notation for [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate?
The canonical SMILES for [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate is CC[C@H](CCOC(=O)[C@H](C)CC)OC(=O)[C@H](C)CC.
What is the InChIKey of [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate?
The InChIKey is XJEVJEIFRGPKIE-JHJVBQTASA-N. The full InChI is InChI=1S/C15H28O4/c1-6-11(4)14(16)18-10-9-13(8-3)19-15(17)12(5)7-2/h11-13H,6-10H2,1-5H3/t11-,12-,13-/m1/s1.
What are the key properties of [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate?
[(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate has a molecular weight of 272.38 g/mol, XLogP of 3.33, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-[(2R)-2-methylbutanoyl]oxypentyl] (2R)-2-methylbutanoate is sourced from PubChem (CID 98854584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).