C18H26N2O5 — CID 98856515
methyl (2R)-2-[[(6R,10S)-6,10-dimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-5-methyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 98856515) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl (2R)-2-[[(6R,10S)-6,10-dimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-5-methyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | methyl (2R)-2-[[(6R,10S)-6,10-dimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-5-methyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 98856515 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl (2R)-2-[[(6R,10S)-6,10-dimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-5-methyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | COC(=O)C1=C(C)O[C@@H](CN2C(=O)NC3(C2=O)[C@H](C)CCC[C@@H]3C)C1 |
| InChI | InChI=1S/C18H26N2O5/c1-10-6-5-7-11(2)18(10)16(22)20(17(23)19-18)9-13-8-14(12(3)25-13)15(21)24-4/h10-11,13H,5-9H2,1-4H3,(H,19,23)/t10-,11+,13-,18?/m1/s1 |
| InChIKey | PJMNSTZSIYELFD-TZNHPFGPSA-N |
| XLogP | 1.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|