C33H35NO4S — CID 98861760
ethyl (1R,2S,9S,12S)-16-methoxy-9-methyl-6-[[(E)-3-phenylprop-2-enoyl]amino]-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate (PubChem CID 98861760) has the molecular formula C33H35NO4S and a molecular weight of 541.71 g/mol. Its IUPAC name is ethyl (1R,2S,9S,12S)-16-methoxy-9-methyl-6-[[(E)-3-phenylprop-2-enoyl]amino]-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate.
| Compound Name | ethyl (1R,2S,9S,12S)-16-methoxy-9-methyl-6-[[(E)-3-phenylprop-2-enoyl]amino]-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate |
|---|---|
| PubChem CID | 98861760 |
| Molecular Formula | C33H35NO4S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | ethyl (1R,2S,9S,12S)-16-methoxy-9-methyl-6-[[(E)-3-phenylprop-2-enoyl]amino]-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccccc2)sc2c1[C@@]1(C)CC[C@@H]3c4ccc(OC)cc4CC[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C33H35NO4S/c1-4-38-32(36)29-30-27(39-31(29)34-28(35)15-10-20-8-6-5-7-9-20)19-26-25-13-11-21-18-22(37-3)12-14-23(21)24(25)16-17-33(26,30)2/h5-10,12,14-15,18,24-26H,4,11,13,16-17,19H2,1-3H3,(H,34,35)/b15-10+/t24-,25+,26+,33+/m1/s1 |
| InChIKey | VIKJOKCIPIWXFM-JQHCTJTLSA-N |
| XLogP | 7.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|