C22H20FN3O — CID 98869555
(E)-3-(2-fluorophenyl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]prop-2-enamide (PubChem CID 98869555) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 98869555 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1ccc(-c2cn3c(n2)CCCC3)cc1 |
| InChI | InChI=1S/C22H20FN3O/c23-19-6-2-1-5-16(19)10-13-22(27)24-18-11-8-17(9-12-18)20-15-26-14-4-3-7-21(26)25-20/h1-2,5-6,8-13,15H,3-4,7,14H2,(H,24,27)/b13-10+ |
| InChIKey | HLUJBVFBPXARRJ-JLHYYAGUSA-N |
| XLogP | 4.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|