C18H28N2O3 — CID 98878165
(3R)-3-(2-methyl-1,3-dioxolan-2-yl)-N-[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]piperidine-1-carboxamide (PubChem CID 98878165) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3R)-3-(2-methyl-1,3-dioxolan-2-yl)-N-[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(2-methyl-1,3-dioxolan-2-yl)-N-[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 98878165 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (3R)-3-(2-methyl-1,3-dioxolan-2-yl)-N-[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]piperidine-1-carboxamide |
| SMILES | CC1([C@@H]2CCCN(C(=O)NC3[C@H]4[C@H]5CC[C@@H](C5)[C@H]34)C2)OCCO1 |
| InChI | InChI=1S/C18H28N2O3/c1-18(22-7-8-23-18)13-3-2-6-20(10-13)17(21)19-16-14-11-4-5-12(9-11)15(14)16/h11-16H,2-10H2,1H3,(H,19,21)/t11-,12-,13+,14-,15-/m0/s1 |
| InChIKey | RMGXCOANKBEENE-RMEBNNNOSA-N |
| XLogP | 2.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |