C15H24N6O — CID 98891261
trans-(1R,2R)-N-[(1S)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-methylcyclopentan-1-amine (PubChem CID 98891261) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(1S)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-methylcyclopentan-1-amine.
| Compound Name | trans-(1R,2R)-N-[(1S)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 98891261 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | trans-(1R,2R)-N-[(1S)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-methylcyclopentan-1-amine |
| SMILES | C[C@@H]1CCC[C@H]1N[C@H](c1nc(-c2ncn[nH]2)no1)C(C)(C)C |
| InChI | InChI=1S/C15H24N6O/c1-9-6-5-7-10(9)18-11(15(2,3)4)14-19-13(21-22-14)12-16-8-17-20-12/h8-11,18H,5-7H2,1-4H3,(H,16,17,20)/t9-,10-,11-/m1/s1 |
| InChIKey | YMCSXQTXCPQEKR-GMTAPVOTSA-N |
| XLogP | 2.72 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |