C18H29N5O — CID 98892065
(2S,3aR,7aS)-N-[2-[ethyl(methyl)amino]ethyl]-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 98892065) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is (2S,3aR,7aS)-N-[2-[ethyl(methyl)amino]ethyl]-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aS)-N-[2-[ethyl(methyl)amino]ethyl]-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 98892065 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | (2S,3aR,7aS)-N-[2-[ethyl(methyl)amino]ethyl]-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCN(C)CCNC(=O)[C@@H]1C[C@H]2CCCC[C@@H]2N1c1ncccn1 |
| InChI | InChI=1S/C18H29N5O/c1-3-22(2)12-11-19-17(24)16-13-14-7-4-5-8-15(14)23(16)18-20-9-6-10-21-18/h6,9-10,14-16H,3-5,7-8,11-13H2,1-2H3,(H,19,24)/t14-,15+,16+/m1/s1 |
| InChIKey | ZTUWFVCZXWVJLB-PMPSAXMXSA-N |
| XLogP | 1.68 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |