C19H22FN3O3 — CID 98894449
5-[[(3aR,6S,6aR)-6-(oxazinane-2-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-2-fluorobenzonitrile (PubChem CID 98894449) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 5-[[(3aR,6S,6aR)-6-(oxazinane-2-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(3aR,6S,6aR)-6-(oxazinane-2-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 98894449 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-[[(3aR,6S,6aR)-6-(oxazinane-2-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CN2C[C@H](C(=O)N3CCCCO3)[C@H]3OCC[C@H]32)ccc1F |
| InChI | InChI=1S/C19H22FN3O3/c20-16-4-3-13(9-14(16)10-21)11-22-12-15(18-17(22)5-8-25-18)19(24)23-6-1-2-7-26-23/h3-4,9,15,17-18H,1-2,5-8,11-12H2/t15-,17+,18+/m0/s1 |
| InChIKey | DRBGSECNRFPADO-CGTJXYLNSA-N |
| XLogP | 1.84 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |