C17H20F2N2O2 — CID 98894774
(3aR,6S,6aR)-N-cyclopropyl-4-[(2,3-difluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98894774) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3aR,6S,6aR)-N-cyclopropyl-4-[(2,3-difluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-N-cyclopropyl-4-[(2,3-difluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98894774 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (3aR,6S,6aR)-N-cyclopropyl-4-[(2,3-difluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1CN(Cc2cccc(F)c2F)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C17H20F2N2O2/c18-13-3-1-2-10(15(13)19)8-21-9-12(16-14(21)6-7-23-16)17(22)20-11-4-5-11/h1-3,11-12,14,16H,4-9H2,(H,20,22)/t12-,14+,16+/m0/s1 |
| InChIKey | CXOMIXIVNQIMQM-JGGQBBKZSA-N |
| XLogP | 1.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |