C15H23N5O2 — CID 98894870
2-[(3aR,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-N,N-dimethylacetamide (PubChem CID 98894870) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[(3aR,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aR,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 98894870 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-[(3aR,6aS)-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-N,N-dimethylacetamide |
| SMILES | COc1cc(N2CC[C@H]3[C@H]2CCN3CC(=O)N(C)C)ncn1 |
| InChI | InChI=1S/C15H23N5O2/c1-18(2)15(21)9-19-6-4-12-11(19)5-7-20(12)13-8-14(22-3)17-10-16-13/h8,10-12H,4-7,9H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | HRRGDYYSJQXNJG-NWDGAFQWSA-N |
| XLogP | 0.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |