C19H22FN3O2 — CID 98895074
(3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N-cyclobutyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895074) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N-cyclobutyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N-cyclobutyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895074 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N-cyclobutyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | N#Cc1cc(CN2C[C@H](C(=O)NC3CCC3)[C@H]3OCC[C@H]32)ccc1F |
| InChI | InChI=1S/C19H22FN3O2/c20-16-5-4-12(8-13(16)9-21)10-23-11-15(18-17(23)6-7-25-18)19(24)22-14-2-1-3-14/h4-5,8,14-15,17-18H,1-3,6-7,10-11H2,(H,22,24)/t15-,17+,18+/m0/s1 |
| InChIKey | UMQTZOYIQVHWAT-CGTJXYLNSA-N |
| XLogP | 1.96 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |