C15H24N2O3 — CID 98895110
(5S)-9-(oxane-4-carbonyl)-2,9-diazaspiro[4.6]undecan-1-one (PubChem CID 98895110) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (5S)-9-(oxane-4-carbonyl)-2,9-diazaspiro[4.6]undecan-1-one.
| Compound Name | (5S)-9-(oxane-4-carbonyl)-2,9-diazaspiro[4.6]undecan-1-one |
|---|---|
| PubChem CID | 98895110 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (5S)-9-(oxane-4-carbonyl)-2,9-diazaspiro[4.6]undecan-1-one |
| SMILES | O=C(C1CCOCC1)N1CCC[C@]2(CCNC2=O)CC1 |
| InChI | InChI=1S/C15H24N2O3/c18-13(12-2-10-20-11-3-12)17-8-1-4-15(6-9-17)5-7-16-14(15)19/h12H,1-11H2,(H,16,19)/t15-/m0/s1 |
| InChIKey | VNIMOVTURFUYFE-HNNXBMFYSA-N |
| XLogP | 0.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |