C17H20FN3O2 — CID 98895182
(3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895182) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895182 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3aR,6S,6aR)-4-[(3-cyano-4-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CN(Cc2ccc(F)c(C#N)c2)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C17H20FN3O2/c1-20(2)17(22)13-10-21(15-5-6-23-16(13)15)9-11-3-4-14(18)12(7-11)8-19/h3-4,7,13,15-16H,5-6,9-10H2,1-2H3/t13-,15+,16+/m0/s1 |
| InChIKey | RBUZDTZGEKTJKU-NUEKZKHPSA-N |
| XLogP | 1.37 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |