C15H23N3O3S — CID 98895386
(3aR,6S,6aR)-N-(2-methoxyethyl)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895386) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is (3aR,6S,6aR)-N-(2-methoxyethyl)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-N-(2-methoxyethyl)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895386 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3aR,6S,6aR)-N-(2-methoxyethyl)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CN(Cc2nc(C)cs2)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C15H23N3O3S/c1-10-9-22-13(17-10)8-18-7-11(14-12(18)3-5-21-14)15(19)16-4-6-20-2/h9,11-12,14H,3-8H2,1-2H3,(H,16,19)/t11-,12+,14+/m0/s1 |
| InChIKey | HNIZSJSRWVDMAS-OUCADQQQSA-N |
| XLogP | 0.80 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|