C14H20N4O2 — CID 98895494
(3aR,6S,6aR)-N-methyl-4-[(2-methylpyrimidin-5-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895494) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3aR,6S,6aR)-N-methyl-4-[(2-methylpyrimidin-5-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-N-methyl-4-[(2-methylpyrimidin-5-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895494 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3aR,6S,6aR)-N-methyl-4-[(2-methylpyrimidin-5-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(Cc2cnc(C)nc2)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C14H20N4O2/c1-9-16-5-10(6-17-9)7-18-8-11(14(19)15-2)13-12(18)3-4-20-13/h5-6,11-13H,3-4,7-8H2,1-2H3,(H,15,19)/t11-,12+,13+/m0/s1 |
| InChIKey | OSJSRIFRZRVWRO-YNEHKIRRSA-N |
| XLogP | 0.12 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |