C17H20N4O2S — CID 98896440
[(3aR,6aR)-3a-[(pyridin-2-ylamino)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 98896440) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is [(3aR,6aR)-3a-[(pyridin-2-ylamino)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aR,6aR)-3a-[(pyridin-2-ylamino)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 98896440 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(3aR,6aR)-3a-[(pyridin-2-ylamino)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2C[C@@H]3COC[C@]3(CNc3ccccn3)C2)cs1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-20-14(8-24-12)16(22)21-6-13-7-23-11-17(13,10-21)9-19-15-4-2-3-5-18-15/h2-5,8,13H,6-7,9-11H2,1H3,(H,18,19)/t13-,17+/m1/s1 |
| InChIKey | RGWQFKKGQHYHLG-DYVFJYSZSA-N |
| XLogP | 2.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |