C18H28N4O3 — CID 98896897
(3aR,6S,6aR)-4-[(3-methylimidazol-4-yl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98896897) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(3-methylimidazol-4-yl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(3-methylimidazol-4-yl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98896897 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (3aR,6S,6aR)-4-[(3-methylimidazol-4-yl)methyl]-N-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | Cn1cncc1CN1C[C@H](C(=O)NCC2CCOCC2)[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C18H28N4O3/c1-21-12-19-9-14(21)10-22-11-15(17-16(22)4-7-25-17)18(23)20-8-13-2-5-24-6-3-13/h9,12-13,15-17H,2-8,10-11H2,1H3,(H,20,23)/t15-,16+,17+/m0/s1 |
| InChIKey | ZFNGUAZBJSZODD-GVDBMIGSSA-N |
| XLogP | 0.55 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |