C15H23N3O2S — CID 98897404
(3aR,6S,6aR)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98897404) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98897404 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3aR,6S,6aR)-4-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | Cc1csc(CN2C[C@H](C(=O)NC(C)C)[C@H]3OCC[C@H]32)n1 |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)16-15(19)11-6-18(12-4-5-20-14(11)12)7-13-17-10(3)8-21-13/h8-9,11-12,14H,4-7H2,1-3H3,(H,16,19)/t11-,12+,14+/m0/s1 |
| InChIKey | NLEDECMYANMELS-OUCADQQQSA-N |
| XLogP | 1.57 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |