C16H24N4O2 — CID 98897595
[(4aS,8aS)-4-(cyclopropylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-4-yl)methanone (PubChem CID 98897595) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(4aS,8aS)-4-(cyclopropylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-4-yl)methanone.
| Compound Name | [(4aS,8aS)-4-(cyclopropylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 98897595 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(4aS,8aS)-4-(cyclopropylmethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-methylimidazol-4-yl)methanone |
| SMILES | Cn1cnc(C(=O)N2CC[C@@H]3OCCN(CC4CC4)[C@H]3C2)c1 |
| InChI | InChI=1S/C16H24N4O2/c1-18-9-13(17-11-18)16(21)20-5-4-15-14(10-20)19(6-7-22-15)8-12-2-3-12/h9,11-12,14-15H,2-8,10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | ZBYCWLURKTXOBZ-GJZGRUSLSA-N |
| XLogP | 0.75 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |