C17H23FN2O3 — CID 98897654
(3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98897654) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98897654 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CN(Cc2ccccc2F)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C17H23FN2O3/c1-22-9-7-19-17(21)13-11-20(15-6-8-23-16(13)15)10-12-4-2-3-5-14(12)18/h2-5,13,15-16H,6-11H2,1H3,(H,19,21)/t13-,15+,16+/m0/s1 |
| InChIKey | XUCLNXYISSVFAC-NUEKZKHPSA-N |
| XLogP | 1.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|