About 1,1,2-trifluoroethane
1,1,2-trifluoroethane (PubChem CID 9890) has the molecular formula C2H3F3
and a molecular weight of 84.04 g/mol. Its IUPAC name is 1,1,2-trifluoroethane.
Molecular Properties
| Compound Name | 1,1,2-trifluoroethane |
| PubChem CID | 9890 |
| Molecular Formula | C2H3F3 |
| Molecular Weight | 84.04 g/mol |
| Exact Mass | 84.02 |
| IUPAC Name | 1,1,2-trifluoroethane |
| SMILES | FCC(F)F |
| InChI | InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2 |
| InChIKey | WGZYQOSEVSXDNI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.04 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluoroethane?
The IUPAC name of 1,1,2-trifluoroethane (CID 9890) is 1,1,2-trifluoroethane.
What is the SMILES notation for 1,1,2-trifluoroethane?
The canonical SMILES for 1,1,2-trifluoroethane is FCC(F)F.
What is the InChIKey of 1,1,2-trifluoroethane?
The InChIKey is WGZYQOSEVSXDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2.
What are the key properties of 1,1,2-trifluoroethane?
1,1,2-trifluoroethane has a molecular weight of 84.04 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoroethane is sourced from PubChem (CID 9890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).